C15H22ClNOS — CID 65238018
N-(2-chloroethyl)-N-cyclohexyl-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65238018) has the molecular formula C15H22ClNOS and a molecular weight of 299.87 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-cyclohexyl-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(2-chloroethyl)-N-cyclohexyl-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65238018 |
| Molecular Formula | C15H22ClNOS |
| Molecular Weight | 299.87 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-(2-chloroethyl)-N-cyclohexyl-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(CCCl)C2CCCCC2)sc1C |
| InChI | InChI=1S/C15H22ClNOS/c1-11-10-14(19-12(11)2)15(18)17(9-8-16)13-6-4-3-5-7-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | TZKXOZMVXOBKEX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|