C18H17BrS — CID 65238268
5-(1-bromo-2-naphthalen-1-ylethyl)-2,3-dimethylthiophene (PubChem CID 65238268) has the molecular formula C18H17BrS and a molecular weight of 345.31 g/mol. Its IUPAC name is 5-(1-bromo-2-naphthalen-1-ylethyl)-2,3-dimethylthiophene.
| Compound Name | 5-(1-bromo-2-naphthalen-1-ylethyl)-2,3-dimethylthiophene |
|---|---|
| PubChem CID | 65238268 |
| Molecular Formula | C18H17BrS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 5-(1-bromo-2-naphthalen-1-ylethyl)-2,3-dimethylthiophene |
| SMILES | Cc1cc(C(Br)Cc2cccc3ccccc23)sc1C |
| InChI | InChI=1S/C18H17BrS/c1-12-10-18(20-13(12)2)17(19)11-15-8-5-7-14-6-3-4-9-16(14)15/h3-10,17H,11H2,1-2H3 |
| InChIKey | XVCIFLWWZNGGEU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|