C18H13Br3 — CID 114375566
1-[2-bromo-2-(2,5-dibromophenyl)ethyl]naphthalene (PubChem CID 114375566) has the molecular formula C18H13Br3 and a molecular weight of 469.01 g/mol. Its IUPAC name is 1-[2-bromo-2-(2,5-dibromophenyl)ethyl]naphthalene.
| Compound Name | 1-[2-bromo-2-(2,5-dibromophenyl)ethyl]naphthalene |
|---|---|
| PubChem CID | 114375566 |
| Molecular Formula | C18H13Br3 |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 465.86 |
| IUPAC Name | 1-[2-bromo-2-(2,5-dibromophenyl)ethyl]naphthalene |
| SMILES | Brc1ccc(Br)c(C(Br)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C18H13Br3/c19-14-8-9-17(20)16(11-14)18(21)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-9,11,18H,10H2 |
| InChIKey | JDGQTWPAVOUDQU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|