C15H17ClOS — CID 65238549
5-[chloro-(2-methoxy-5-methylphenyl)methyl]-2,3-dimethylthiophene (PubChem CID 65238549) has the molecular formula C15H17ClOS and a molecular weight of 280.82 g/mol. Its IUPAC name is 5-[chloro-(2-methoxy-5-methylphenyl)methyl]-2,3-dimethylthiophene.
| Compound Name | 5-[chloro-(2-methoxy-5-methylphenyl)methyl]-2,3-dimethylthiophene |
|---|---|
| PubChem CID | 65238549 |
| Molecular Formula | C15H17ClOS |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 5-[chloro-(2-methoxy-5-methylphenyl)methyl]-2,3-dimethylthiophene |
| SMILES | COc1ccc(C)cc1C(Cl)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C15H17ClOS/c1-9-5-6-13(17-4)12(7-9)15(16)14-8-10(2)11(3)18-14/h5-8,15H,1-4H3 |
| InChIKey | FQGJFYDJXPQZTN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|