C12H25N3 — CID 65251112
4-(azepan-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65251112) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-(azepan-1-yl)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(azepan-1-yl)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65251112 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 4-(azepan-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN1CCCCCC1 |
| InChI | InChI=1S/C12H25N3/c1-12(2,11(13)14)7-10-15-8-5-3-4-6-9-15/h3-10H2,1-2H3,(H3,13,14) |
| InChIKey | HFDUXKSXBMBKIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|