About 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile
4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile (PubChem CID 65251709) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile.
Analyze 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile?
The IUPAC name of 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile (CID 65251709) is 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile is CCN(CCC(C)(C)C#N)C1CCCC1.
What is the InChIKey of 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile?
The InChIKey is SPAFBXKTNAHMSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-4-15(12-7-5-6-8-12)10-9-13(2,3)11-14/h12H,4-10H2,1-3H3.
What are the key properties of 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile?
4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile has a molecular weight of 208.35 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclopentyl(ethyl)amino]-2,2-dimethylbutanenitrile is sourced from PubChem (CID 65251709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).