About 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile
5-(dicyclohexylamino)-2,2-dimethylpentanenitrile (PubChem CID 65257781) has the molecular formula C19H34N2
and a molecular weight of 290.49 g/mol. Its IUPAC name is 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile |
| PubChem CID | 65257781 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H34N2/c1-19(2,16-20)14-9-15-21(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h17-18H,3-15H2,1-2H3 |
| InChIKey | WMPPKOWUHLKEMV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile?
The IUPAC name of 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile (CID 65257781) is 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile.
What is the SMILES notation for 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile?
The canonical SMILES for 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile is CC(C)(C#N)CCCN(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile?
The InChIKey is WMPPKOWUHLKEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34N2/c1-19(2,16-20)14-9-15-21(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h17-18H,3-15H2,1-2H3.
What are the key properties of 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile?
5-(dicyclohexylamino)-2,2-dimethylpentanenitrile has a molecular weight of 290.49 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile is sourced from PubChem (CID 65257781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).