C19H34N2 — CID 65257781
5-(dicyclohexylamino)-2,2-dimethylpentanenitrile (PubChem CID 65257781) has the molecular formula C19H34N2 and a molecular weight of 290.49 g/mol. Its IUPAC name is 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65257781 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 5-(dicyclohexylamino)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C19H34N2/c1-19(2,16-20)14-9-15-21(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h17-18H,3-15H2,1-2H3 |
| InChIKey | WMPPKOWUHLKEMV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |