C10H18N4S — CID 65251976
2,2-dimethyl-4-(1-methylpyrazol-4-yl)sulfanylbutanimidamide (PubChem CID 65251976) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 2,2-dimethyl-4-(1-methylpyrazol-4-yl)sulfanylbutanimidamide.
| Compound Name | 2,2-dimethyl-4-(1-methylpyrazol-4-yl)sulfanylbutanimidamide |
|---|---|
| PubChem CID | 65251976 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2,2-dimethyl-4-(1-methylpyrazol-4-yl)sulfanylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSc1cnn(C)c1 |
| InChI | InChI=1S/C10H18N4S/c1-10(2,9(11)12)4-5-15-8-6-13-14(3)7-8/h6-7H,4-5H2,1-3H3,(H3,11,12) |
| InChIKey | XBHGIRPGHBLIIX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|