C10H23NO2S — CID 65256393
4-butan-2-ylsulfonyl-2,2-dimethylbutan-1-amine (PubChem CID 65256393) has the molecular formula C10H23NO2S and a molecular weight of 221.37 g/mol. Its IUPAC name is 4-butan-2-ylsulfonyl-2,2-dimethylbutan-1-amine.
| Compound Name | 4-butan-2-ylsulfonyl-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 65256393 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-butan-2-ylsulfonyl-2,2-dimethylbutan-1-amine |
| SMILES | CCC(C)S(=O)(=O)CCC(C)(C)CN |
| InChI | InChI=1S/C10H23NO2S/c1-5-9(2)14(12,13)7-6-10(3,4)8-11/h9H,5-8,11H2,1-4H3 |
| InChIKey | XJDDCEYJEUALJJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |