C14H31NO2S — CID 106735479
3,3-dimethyl-N-(2-methylpropyl)-5-propan-2-ylsulfonylpentan-1-amine (PubChem CID 106735479) has the molecular formula C14H31NO2S and a molecular weight of 277.47 g/mol. Its IUPAC name is 3,3-dimethyl-N-(2-methylpropyl)-5-propan-2-ylsulfonylpentan-1-amine.
| Compound Name | 3,3-dimethyl-N-(2-methylpropyl)-5-propan-2-ylsulfonylpentan-1-amine |
|---|---|
| PubChem CID | 106735479 |
| Molecular Formula | C14H31NO2S |
| Molecular Weight | 277.47 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 3,3-dimethyl-N-(2-methylpropyl)-5-propan-2-ylsulfonylpentan-1-amine |
| SMILES | CC(C)CNCCC(C)(C)CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H31NO2S/c1-12(2)11-15-9-7-14(5,6)8-10-18(16,17)13(3)4/h12-13,15H,7-11H2,1-6H3 |
| InChIKey | HCZIZMWYXPGCOU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|