C15H31NO2S — CID 106730330
2-cyclopropyl-2-methyl-N-(2-methylpropyl)-4-propan-2-ylsulfonylbutan-1-amine (PubChem CID 106730330) has the molecular formula C15H31NO2S and a molecular weight of 289.49 g/mol. Its IUPAC name is 2-cyclopropyl-2-methyl-N-(2-methylpropyl)-4-propan-2-ylsulfonylbutan-1-amine.
| Compound Name | 2-cyclopropyl-2-methyl-N-(2-methylpropyl)-4-propan-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 106730330 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | 2-cyclopropyl-2-methyl-N-(2-methylpropyl)-4-propan-2-ylsulfonylbutan-1-amine |
| SMILES | CC(C)CNCC(C)(CCS(=O)(=O)C(C)C)C1CC1 |
| InChI | InChI=1S/C15H31NO2S/c1-12(2)10-16-11-15(5,14-6-7-14)8-9-19(17,18)13(3)4/h12-14,16H,6-11H2,1-5H3 |
| InChIKey | MPAVHQCAYUAUDK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |