C14H29NO3S — CID 106730333
2-cyclopropyl-N-(2-methoxyethyl)-2-methyl-4-propan-2-ylsulfonylbutan-1-amine (PubChem CID 106730333) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is 2-cyclopropyl-N-(2-methoxyethyl)-2-methyl-4-propan-2-ylsulfonylbutan-1-amine.
| Compound Name | 2-cyclopropyl-N-(2-methoxyethyl)-2-methyl-4-propan-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 106730333 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-cyclopropyl-N-(2-methoxyethyl)-2-methyl-4-propan-2-ylsulfonylbutan-1-amine |
| SMILES | COCCNCC(C)(CCS(=O)(=O)C(C)C)C1CC1 |
| InChI | InChI=1S/C14H29NO3S/c1-12(2)19(16,17)10-7-14(3,13-5-6-13)11-15-8-9-18-4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | MNRCWKOZXKMKLP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|