C17H35N — CID 81034089
3-(3,4-dimethylcyclohexyl)-3-methyl-N-(2-methylpropyl)butan-1-amine (PubChem CID 81034089) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)-3-methyl-N-(2-methylpropyl)butan-1-amine.
| Compound Name | 3-(3,4-dimethylcyclohexyl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
|---|---|
| PubChem CID | 81034089 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)-3-methyl-N-(2-methylpropyl)butan-1-amine |
| SMILES | CC(C)CNCCC(C)(C)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C17H35N/c1-13(2)12-18-10-9-17(5,6)16-8-7-14(3)15(4)11-16/h13-16,18H,7-12H2,1-6H3 |
| InChIKey | KZOCCVQCKCMSQE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|