C12H24F3N3 — CID 65258329
2,2-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanimidamide (PubChem CID 65258329) has the molecular formula C12H24F3N3 and a molecular weight of 267.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanimidamide.
| Compound Name | 2,2-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanimidamide |
|---|---|
| PubChem CID | 65258329 |
| Molecular Formula | C12H24F3N3 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 2,2-dimethyl-5-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H24F3N3/c1-9(2)18(8-12(13,14)15)7-5-6-11(3,4)10(16)17/h9H,5-8H2,1-4H3,(H3,16,17) |
| InChIKey | QGPBPORUTGGNDC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|