C13H27N3O — CID 65259018
5-[2-(hydroxymethyl)piperidin-1-yl]-2,2-dimethylpentanimidamide (PubChem CID 65259018) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 5-[2-(hydroxymethyl)piperidin-1-yl]-2,2-dimethylpentanimidamide.
| Compound Name | 5-[2-(hydroxymethyl)piperidin-1-yl]-2,2-dimethylpentanimidamide |
|---|---|
| PubChem CID | 65259018 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 5-[2-(hydroxymethyl)piperidin-1-yl]-2,2-dimethylpentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCN1CCCCC1CO |
| InChI | InChI=1S/C13H27N3O/c1-13(2,12(14)15)7-5-9-16-8-4-3-6-11(16)10-17/h11,17H,3-10H2,1-2H3,(H3,14,15) |
| InChIKey | CRGUCPYXDJXJLV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|