C21H17N3O5S2 — CID 6526481
2-(1,3-dioxoisoindol-2-yl)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide (PubChem CID 6526481) has the molecular formula C21H17N3O5S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 6526481 |
| Molecular Formula | C21H17N3O5S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-[(5Z)-2,4-dioxo-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]ethyl]propanamide |
| SMILES | CC(C(=O)NCCN1C(=O)S/C(=C\c2cccs2)C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H17N3O5S2/c1-12(24-18(26)14-6-2-3-7-15(14)19(24)27)17(25)22-8-9-23-20(28)16(31-21(23)29)11-13-5-4-10-30-13/h2-7,10-12H,8-9H2,1H3,(H,22,25)/b16-11- |
| InChIKey | LYEATQFXVRIGQA-WJDWOHSUSA-N |
| XLogP | 2.59 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|