C15H23N3O2 — CID 65264856
4-[(3-amino-2,2,3-trimethylbutanoyl)amino]-3-methylbenzamide (PubChem CID 65264856) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-[(3-amino-2,2,3-trimethylbutanoyl)amino]-3-methylbenzamide.
| Compound Name | 4-[(3-amino-2,2,3-trimethylbutanoyl)amino]-3-methylbenzamide |
|---|---|
| PubChem CID | 65264856 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 4-[(3-amino-2,2,3-trimethylbutanoyl)amino]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C15H23N3O2/c1-9-8-10(12(16)19)6-7-11(9)18-13(20)14(2,3)15(4,5)17/h6-8H,17H2,1-5H3,(H2,16,19)(H,18,20) |
| InChIKey | VRCPWSSJWOINPI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |