C14H19BrN2O3 — CID 107813419
3-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-bromobenzoic acid (PubChem CID 107813419) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-bromobenzoic acid.
| Compound Name | 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-bromobenzoic acid |
|---|---|
| PubChem CID | 107813419 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 3-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-bromobenzoic acid |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1cc(C(=O)O)ccc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-13(2,14(3,4)16)12(20)17-10-7-8(11(18)19)5-6-9(10)15/h5-7H,16H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | CHOGMVXNWGZGRG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |