About 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid
2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid (PubChem CID 65266431) has the molecular formula C9H15N3O2S
and a molecular weight of 229.31 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid.
Analyze 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid?
The IUPAC name of 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid (CID 65266431) is 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid.
What is the SMILES notation for 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid?
The canonical SMILES for 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid is CC(C)(Nc1nncs1)C(C)(C)C(=O)O.
What is the InChIKey of 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid?
The InChIKey is GYLNHOXWOXURIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2S/c1-8(2,6(13)14)9(3,4)11-7-12-10-5-15-7/h5H,1-4H3,(H,11,12)(H,13,14).
What are the key properties of 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid?
2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid has a molecular weight of 229.31 g/mol, XLogP of 1.84, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3-trimethyl-3-(1,3,4-thiadiazol-2-ylamino)butanoic acid is sourced from PubChem (CID 65266431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).