C11H12N2OS2 — CID 65274596
4-[(3-propyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol (PubChem CID 65274596) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-[(3-propyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol.
| Compound Name | 4-[(3-propyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol |
|---|---|
| PubChem CID | 65274596 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-[(3-propyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol |
| SMILES | CCCc1nsc(Sc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C11H12N2OS2/c1-2-3-10-12-11(16-13-10)15-9-6-4-8(14)5-7-9/h4-7,14H,2-3H2,1H3 |
| InChIKey | JKHPDEYAEIRRFU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |