C12H14N2OS2 — CID 65274654
2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol (PubChem CID 65274654) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol.
| Compound Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol |
|---|---|
| PubChem CID | 65274654 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)sulfanyl]phenol |
| SMILES | CC(C)(C)c1nsc(Sc2ccccc2O)n1 |
| InChI | InChI=1S/C12H14N2OS2/c1-12(2,3)10-13-11(17-14-10)16-9-7-5-4-6-8(9)15/h4-7,15H,1-3H3 |
| InChIKey | ZFZWRDQSBDTKCL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |