C9H15N3OS — CID 65274887
2-[1-(1,2,4-thiadiazol-5-yl)piperidin-3-yl]ethanol (PubChem CID 65274887) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-[1-(1,2,4-thiadiazol-5-yl)piperidin-3-yl]ethanol.
| Compound Name | 2-[1-(1,2,4-thiadiazol-5-yl)piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 65274887 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-[1-(1,2,4-thiadiazol-5-yl)piperidin-3-yl]ethanol |
| SMILES | OCCC1CCCN(c2ncns2)C1 |
| InChI | InChI=1S/C9H15N3OS/c13-5-3-8-2-1-4-12(6-8)9-10-7-11-14-9/h7-8,13H,1-6H2 |
| InChIKey | KSHNFXAPOUGOFG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |