C18H12N4O3S — CID 6527502
[3-[(Z)-(6-oxo-2-pyridin-4-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene)methyl]phenyl] acetate (PubChem CID 6527502) has the molecular formula C18H12N4O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is [3-[(Z)-(6-oxo-2-pyridin-4-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene)methyl]phenyl] acetate.
| Compound Name | [3-[(Z)-(6-oxo-2-pyridin-4-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 6527502 |
| Molecular Formula | C18H12N4O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | [3-[(Z)-(6-oxo-2-pyridin-4-yl-[1,3]thiazolo[3,2-b][1,2,4]triazol-5-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(/C=c2\sc3nc(-c4ccncc4)nn3c2=O)c1 |
| InChI | InChI=1S/C18H12N4O3S/c1-11(23)25-14-4-2-3-12(9-14)10-15-17(24)22-18(26-15)20-16(21-22)13-5-7-19-8-6-13/h2-10H,1H3/b15-10- |
| InChIKey | AZBLTVAPPMVSDE-GDNBJRDFSA-N |
| XLogP | 1.69 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|