C15H11N3O4S — CID 750781
[3-[(6-methyl-3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate (PubChem CID 750781) has the molecular formula C15H11N3O4S and a molecular weight of 329.34 g/mol. Its IUPAC name is [3-[(6-methyl-3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate.
| Compound Name | [3-[(6-methyl-3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate |
|---|---|
| PubChem CID | 750781 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [3-[(6-methyl-3,7-dioxo-[1,3]thiazolo[3,2-b][1,2,4]triazin-2-ylidene)methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C=c2sc3nc(=O)c(C)nn3c2=O)c1 |
| InChI | InChI=1S/C15H11N3O4S/c1-8-13(20)16-15-18(17-8)14(21)12(23-15)7-10-4-3-5-11(6-10)22-9(2)19/h3-7H,1-2H3 |
| InChIKey | OPSXPFKATBLSNO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_H(5)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|