C10H10FN3S — CID 65276833
N-[1-(4-fluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65276833) has the molecular formula C10H10FN3S and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65276833 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CC(Nc1ncns1)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10FN3S/c1-7(14-10-12-6-13-15-10)8-2-4-9(11)5-3-8/h2-7H,1H3,(H,12,13,14) |
| InChIKey | NXTPSDOQFGONLU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |