C5H4N4S — CID 65277359
5-pyrazol-1-yl-1,2,4-thiadiazole (PubChem CID 65277359) has the molecular formula C5H4N4S and a molecular weight of 152.18 g/mol. Its IUPAC name is 5-pyrazol-1-yl-1,2,4-thiadiazole.
| Compound Name | 5-pyrazol-1-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65277359 |
| Molecular Formula | C5H4N4S |
| Molecular Weight | 152.18 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 5-pyrazol-1-yl-1,2,4-thiadiazole |
| SMILES | c1cnn(-c2ncns2)c1 |
| InChI | InChI=1S/C5H4N4S/c1-2-7-9(3-1)5-6-4-8-10-5/h1-4H |
| InChIKey | QURCGJDNFRMSMS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |