C6H6N4S — CID 66520615
2-pyrazol-1-yl-1,3-thiazol-4-amine (PubChem CID 66520615) has the molecular formula C6H6N4S and a molecular weight of 166.21 g/mol. Its IUPAC name is 2-pyrazol-1-yl-1,3-thiazol-4-amine.
| Compound Name | 2-pyrazol-1-yl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 66520615 |
| Molecular Formula | C6H6N4S |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 2-pyrazol-1-yl-1,3-thiazol-4-amine |
| SMILES | Nc1csc(-n2cccn2)n1 |
| InChI | InChI=1S/C6H6N4S/c7-5-4-11-6(9-5)10-3-1-2-8-10/h1-4H,7H2 |
| InChIKey | FDGCNKCFQXCRGA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |