C14H14BrClO2S — CID 65278187
3-bromo-2-[chloro-(3,4-dimethoxyphenyl)methyl]-5-methylthiophene (PubChem CID 65278187) has the molecular formula C14H14BrClO2S and a molecular weight of 361.69 g/mol. Its IUPAC name is 3-bromo-2-[chloro-(3,4-dimethoxyphenyl)methyl]-5-methylthiophene.
| Compound Name | 3-bromo-2-[chloro-(3,4-dimethoxyphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 65278187 |
| Molecular Formula | C14H14BrClO2S |
| Molecular Weight | 361.69 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | 3-bromo-2-[chloro-(3,4-dimethoxyphenyl)methyl]-5-methylthiophene |
| SMILES | COc1ccc(C(Cl)c2sc(C)cc2Br)cc1OC |
| InChI | InChI=1S/C14H14BrClO2S/c1-8-6-10(15)14(19-8)13(16)9-4-5-11(17-2)12(7-9)18-3/h4-7,13H,1-3H3 |
| InChIKey | OXMGVRWCXLBWGS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|