C14H14BrClS — CID 65278713
3-bromo-2-[chloro-(3,4-dimethylphenyl)methyl]-5-methylthiophene (PubChem CID 65278713) has the molecular formula C14H14BrClS and a molecular weight of 329.69 g/mol. Its IUPAC name is 3-bromo-2-[chloro-(3,4-dimethylphenyl)methyl]-5-methylthiophene.
| Compound Name | 3-bromo-2-[chloro-(3,4-dimethylphenyl)methyl]-5-methylthiophene |
|---|---|
| PubChem CID | 65278713 |
| Molecular Formula | C14H14BrClS |
| Molecular Weight | 329.69 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 3-bromo-2-[chloro-(3,4-dimethylphenyl)methyl]-5-methylthiophene |
| SMILES | Cc1cc(Br)c(C(Cl)c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C14H14BrClS/c1-8-4-5-11(6-9(8)2)13(16)14-12(15)7-10(3)17-14/h4-7,13H,1-3H3 |
| InChIKey | MRIUEQVFLRXDSO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|