C9H16N2OS — CID 65280066
1-(3-ethyl-1,2,4-thiadiazol-5-yl)pentan-2-ol (PubChem CID 65280066) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-(3-ethyl-1,2,4-thiadiazol-5-yl)pentan-2-ol.
| Compound Name | 1-(3-ethyl-1,2,4-thiadiazol-5-yl)pentan-2-ol |
|---|---|
| PubChem CID | 65280066 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(3-ethyl-1,2,4-thiadiazol-5-yl)pentan-2-ol |
| SMILES | CCCC(O)Cc1nc(CC)ns1 |
| InChI | InChI=1S/C9H16N2OS/c1-3-5-7(12)6-9-10-8(4-2)11-13-9/h7,12H,3-6H2,1-2H3 |
| InChIKey | TXFKCMFDSZXKTK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |