C10H11N3S — CID 65280108
1-phenyl-2-(1,2,4-thiadiazol-5-yl)ethanamine (PubChem CID 65280108) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 1-phenyl-2-(1,2,4-thiadiazol-5-yl)ethanamine.
| Compound Name | 1-phenyl-2-(1,2,4-thiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 65280108 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 1-phenyl-2-(1,2,4-thiadiazol-5-yl)ethanamine |
| SMILES | NC(Cc1ncns1)c1ccccc1 |
| InChI | InChI=1S/C10H11N3S/c11-9(6-10-12-7-13-14-10)8-4-2-1-3-5-8/h1-5,7,9H,6,11H2 |
| InChIKey | WVSLPBOVHYJHDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |