C10H14N2OS — CID 65280778
3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pentan-2-one (PubChem CID 65280778) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pentan-2-one.
| Compound Name | 3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pentan-2-one |
|---|---|
| PubChem CID | 65280778 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pentan-2-one |
| SMILES | CCC(C(C)=O)c1nc(C2CC2)ns1 |
| InChI | InChI=1S/C10H14N2OS/c1-3-8(6(2)13)10-11-9(12-14-10)7-4-5-7/h7-8H,3-5H2,1-2H3 |
| InChIKey | YDCYFIDBINCXCT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |