About 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one
2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one (PubChem CID 65281608) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one |
| PubChem CID | 65281608 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one |
| SMILES | CCCC(CN)C(=O)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C14H28N2O/c1-4-6-12(11-15)13(17)16-9-5-7-14(2,3)8-10-16/h12H,4-11,15H2,1-3H3 |
| InChIKey | JNNYSQMETDONIY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one?
The IUPAC name of 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one (CID 65281608) is 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one.
What is the SMILES notation for 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one?
The canonical SMILES for 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one is CCCC(CN)C(=O)N1CCCC(C)(C)CC1.
What is the InChIKey of 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one?
The InChIKey is JNNYSQMETDONIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O/c1-4-6-12(11-15)13(17)16-9-5-7-14(2,3)8-10-16/h12H,4-11,15H2,1-3H3.
What are the key properties of 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one?
2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one has a molecular weight of 240.39 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1-(4,4-dimethylazepan-1-yl)pentan-1-one is sourced from PubChem (CID 65281608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).