About 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine
2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine (PubChem CID 65281870) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine |
| PubChem CID | 65281870 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine |
| SMILES | CC1CCC(N)C(CN2CCCC(C)(C)CC2)C1 |
| InChI | InChI=1S/C16H32N2/c1-13-5-6-15(17)14(11-13)12-18-9-4-7-16(2,3)8-10-18/h13-15H,4-12,17H2,1-3H3 |
| InChIKey | VTXROJPTCHGJFO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine?
The IUPAC name of 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine (CID 65281870) is 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine.
What is the SMILES notation for 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine?
The canonical SMILES for 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine is CC1CCC(N)C(CN2CCCC(C)(C)CC2)C1.
What is the InChIKey of 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine?
The InChIKey is VTXROJPTCHGJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-13-5-6-15(17)14(11-13)12-18-9-4-7-16(2,3)8-10-18/h13-15H,4-12,17H2,1-3H3.
What are the key properties of 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine?
2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine has a molecular weight of 252.45 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-dimethylazepan-1-yl)methyl]-4-methylcyclohexan-1-amine is sourced from PubChem (CID 65281870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).