C16H27BrN2S — CID 65283675
1-(5-bromothiophen-2-yl)-1-(4,4-dimethylazepan-1-yl)butan-2-amine (PubChem CID 65283675) has the molecular formula C16H27BrN2S and a molecular weight of 359.38 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-1-(4,4-dimethylazepan-1-yl)butan-2-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-1-(4,4-dimethylazepan-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 65283675 |
| Molecular Formula | C16H27BrN2S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-1-(4,4-dimethylazepan-1-yl)butan-2-amine |
| SMILES | CCC(N)C(c1ccc(Br)s1)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C16H27BrN2S/c1-4-12(18)15(13-6-7-14(17)20-13)19-10-5-8-16(2,3)9-11-19/h6-7,12,15H,4-5,8-11,18H2,1-3H3 |
| InChIKey | VLBHAKQNPUWINV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |