C13H19NO3S — CID 65284024
4,4-dimethyl-6-(thiophene-2-carbonylamino)hexanoic acid (PubChem CID 65284024) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4,4-dimethyl-6-(thiophene-2-carbonylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(thiophene-2-carbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 65284024 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4,4-dimethyl-6-(thiophene-2-carbonylamino)hexanoic acid |
| SMILES | CC(C)(CCNC(=O)c1cccs1)CCC(=O)O |
| InChI | InChI=1S/C13H19NO3S/c1-13(2,6-5-11(15)16)7-8-14-12(17)10-4-3-9-18-10/h3-4,9H,5-8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | YEOJQGQBZLFBQK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |