C15H28N2O3 — CID 65285664
2-methyl-6-[(2-piperidin-3-ylacetyl)amino]heptanoic acid (PubChem CID 65285664) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-methyl-6-[(2-piperidin-3-ylacetyl)amino]heptanoic acid.
| Compound Name | 2-methyl-6-[(2-piperidin-3-ylacetyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 65285664 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-methyl-6-[(2-piperidin-3-ylacetyl)amino]heptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NC(=O)CC1CCCNC1 |
| InChI | InChI=1S/C15H28N2O3/c1-11(15(19)20)5-3-6-12(2)17-14(18)9-13-7-4-8-16-10-13/h11-13,16H,3-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | SBEWCUCIJFNVAN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |