C15H28N2O3S — CID 114627693
2-methyl-6-[(2-piperidin-4-ylsulfanylacetyl)amino]heptanoic acid (PubChem CID 114627693) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is 2-methyl-6-[(2-piperidin-4-ylsulfanylacetyl)amino]heptanoic acid.
| Compound Name | 2-methyl-6-[(2-piperidin-4-ylsulfanylacetyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 114627693 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-methyl-6-[(2-piperidin-4-ylsulfanylacetyl)amino]heptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C15H28N2O3S/c1-11(15(19)20)4-3-5-12(2)17-14(18)10-21-13-6-8-16-9-7-13/h11-13,16H,3-10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | FLJRLVYQSMEUDQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |