C12H22N2OS — CID 114628059
N-pent-4-en-2-yl-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114628059) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is N-pent-4-en-2-yl-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-pent-4-en-2-yl-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114628059 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-pent-4-en-2-yl-2-piperidin-4-ylsulfanylacetamide |
| SMILES | C=CCC(C)NC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C12H22N2OS/c1-3-4-10(2)14-12(15)9-16-11-5-7-13-8-6-11/h3,10-11,13H,1,4-9H2,2H3,(H,14,15) |
| InChIKey | NIACCDKJACJPRZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|