C14H26N2O3S — CID 114626748
methyl 4-methyl-2-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanoate (PubChem CID 114626748) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is methyl 4-methyl-2-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanoate.
| Compound Name | methyl 4-methyl-2-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 114626748 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | methyl 4-methyl-2-[(2-piperidin-4-ylsulfanylacetyl)amino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CSC1CCNCC1 |
| InChI | InChI=1S/C14H26N2O3S/c1-10(2)8-12(14(18)19-3)16-13(17)9-20-11-4-6-15-7-5-11/h10-12,15H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | DCSSJBZXPSUDOG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |