C17H20N2O3S — CID 6528577
(2Z)-2-[(4-butoxy-3-methoxyphenyl)methylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 6528577) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is (2Z)-2-[(4-butoxy-3-methoxyphenyl)methylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one.
| Compound Name | (2Z)-2-[(4-butoxy-3-methoxyphenyl)methylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one |
|---|---|
| PubChem CID | 6528577 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (2Z)-2-[(4-butoxy-3-methoxyphenyl)methylidene]-5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | CCCCOc1ccc(/C=c2\sc3n(c2=O)CCN=3)cc1OC |
| InChI | InChI=1S/C17H20N2O3S/c1-3-4-9-22-13-6-5-12(10-14(13)21-2)11-15-16(20)19-8-7-18-17(19)23-15/h5-6,10-11H,3-4,7-9H2,1-2H3/b15-11- |
| InChIKey | MGODFNHJSQXEOJ-PTNGSMBKSA-N |
| XLogP | 1.56 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|