C15H29NO2 — CID 65289656
6-[(3,5-dimethylcyclohexyl)amino]-4-methylhexanoic acid (PubChem CID 65289656) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 6-[(3,5-dimethylcyclohexyl)amino]-4-methylhexanoic acid.
| Compound Name | 6-[(3,5-dimethylcyclohexyl)amino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 65289656 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 6-[(3,5-dimethylcyclohexyl)amino]-4-methylhexanoic acid |
| SMILES | CC(CCNC1CC(C)CC(C)C1)CCC(=O)O |
| InChI | InChI=1S/C15H29NO2/c1-11(4-5-15(17)18)6-7-16-14-9-12(2)8-13(3)10-14/h11-14,16H,4-10H2,1-3H3,(H,17,18) |
| InChIKey | WUHGYAYQKZSCKG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |