About tris(4-methylphenyl) phosphate
tris(4-methylphenyl) phosphate (PubChem CID 6529) has the molecular formula C21H21O4P
and a molecular weight of 368.37 g/mol. Its IUPAC name is tris(4-methylphenyl) phosphate.
Molecular Properties
| Compound Name | tris(4-methylphenyl) phosphate |
| PubChem CID | 6529 |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | tris(4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21O4P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | BOSMZFBHAYFUBJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(4-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-methylphenyl) phosphate?
The IUPAC name of tris(4-methylphenyl) phosphate (CID 6529) is tris(4-methylphenyl) phosphate.
What is the SMILES notation for tris(4-methylphenyl) phosphate?
The canonical SMILES for tris(4-methylphenyl) phosphate is Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.
What is the InChIKey of tris(4-methylphenyl) phosphate?
The InChIKey is BOSMZFBHAYFUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O4P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21/h4-15H,1-3H3.
What are the key properties of tris(4-methylphenyl) phosphate?
tris(4-methylphenyl) phosphate has a molecular weight of 368.37 g/mol, XLogP of 6.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-methylphenyl) phosphate is sourced from PubChem (CID 6529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).