C17H28N2O — CID 65290678
6-amino-N,4,4-trimethyl-N-(1-phenylethyl)hexanamide (PubChem CID 65290678) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 6-amino-N,4,4-trimethyl-N-(1-phenylethyl)hexanamide.
| Compound Name | 6-amino-N,4,4-trimethyl-N-(1-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 65290678 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 6-amino-N,4,4-trimethyl-N-(1-phenylethyl)hexanamide |
| SMILES | CC(c1ccccc1)N(C)C(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C17H28N2O/c1-14(15-8-6-5-7-9-15)19(4)16(20)10-11-17(2,3)12-13-18/h5-9,14H,10-13,18H2,1-4H3 |
| InChIKey | YTGIZQNRVXVWAH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |