C17H28N2O2 — CID 65292237
6-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,4,4-trimethylhexanamide (PubChem CID 65292237) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 6-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,4,4-trimethylhexanamide.
| Compound Name | 6-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,4,4-trimethylhexanamide |
|---|---|
| PubChem CID | 65292237 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 6-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,4,4-trimethylhexanamide |
| SMILES | CC(c1ccccc1O)N(C)C(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C17H28N2O2/c1-13(14-7-5-6-8-15(14)20)19(4)16(21)9-10-17(2,3)11-12-18/h5-8,13,20H,9-12,18H2,1-4H3 |
| InChIKey | WLWOYKNKEFKWKB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|