C15H24N2O2 — CID 104684604
5-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,2-dimethylpentanamide (PubChem CID 104684604) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 5-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,2-dimethylpentanamide.
| Compound Name | 5-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 104684604 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 5-amino-N-[1-(2-hydroxyphenyl)ethyl]-N,2-dimethylpentanamide |
| SMILES | CC(CCCN)C(=O)N(C)C(C)c1ccccc1O |
| InChI | InChI=1S/C15H24N2O2/c1-11(7-6-10-16)15(19)17(3)12(2)13-8-4-5-9-14(13)18/h4-5,8-9,11-12,18H,6-7,10,16H2,1-3H3 |
| InChIKey | RDVHVBPYEGERDP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|