C18H30N2O — CID 65291538
6-amino-N-butyl-4,4-dimethyl-N-phenylhexanamide (PubChem CID 65291538) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 6-amino-N-butyl-4,4-dimethyl-N-phenylhexanamide.
| Compound Name | 6-amino-N-butyl-4,4-dimethyl-N-phenylhexanamide |
|---|---|
| PubChem CID | 65291538 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 6-amino-N-butyl-4,4-dimethyl-N-phenylhexanamide |
| SMILES | CCCCN(C(=O)CCC(C)(C)CCN)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-4-5-15-20(16-9-7-6-8-10-16)17(21)11-12-18(2,3)13-14-19/h6-10H,4-5,11-15,19H2,1-3H3 |
| InChIKey | JAMMKSMCNFOGSV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |