C14H30N2O2 — CID 65290826
6-amino-N-butyl-N-(2-hydroxyethyl)-4,4-dimethylhexanamide (PubChem CID 65290826) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 6-amino-N-butyl-N-(2-hydroxyethyl)-4,4-dimethylhexanamide.
| Compound Name | 6-amino-N-butyl-N-(2-hydroxyethyl)-4,4-dimethylhexanamide |
|---|---|
| PubChem CID | 65290826 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 6-amino-N-butyl-N-(2-hydroxyethyl)-4,4-dimethylhexanamide |
| SMILES | CCCCN(CCO)C(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C14H30N2O2/c1-4-5-10-16(11-12-17)13(18)6-7-14(2,3)8-9-15/h17H,4-12,15H2,1-3H3 |
| InChIKey | OGGSITBJDRXQQQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |