C16H27N3O — CID 65292091
6-amino-N-ethyl-4,4-dimethyl-N-(pyridin-4-ylmethyl)hexanamide (PubChem CID 65292091) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 6-amino-N-ethyl-4,4-dimethyl-N-(pyridin-4-ylmethyl)hexanamide.
| Compound Name | 6-amino-N-ethyl-4,4-dimethyl-N-(pyridin-4-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 65292091 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 6-amino-N-ethyl-4,4-dimethyl-N-(pyridin-4-ylmethyl)hexanamide |
| SMILES | CCN(Cc1ccncc1)C(=O)CCC(C)(C)CCN |
| InChI | InChI=1S/C16H27N3O/c1-4-19(13-14-6-11-18-12-7-14)15(20)5-8-16(2,3)9-10-17/h6-7,11-12H,4-5,8-10,13,17H2,1-3H3 |
| InChIKey | PDYMRNCIKGZMEV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |