C14H27N3O2 — CID 65292570
1-(6-amino-4,4-dimethylhexanoyl)piperidine-3-carboxamide (PubChem CID 65292570) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1-(6-amino-4,4-dimethylhexanoyl)piperidine-3-carboxamide.
| Compound Name | 1-(6-amino-4,4-dimethylhexanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 65292570 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-(6-amino-4,4-dimethylhexanoyl)piperidine-3-carboxamide |
| SMILES | CC(C)(CCN)CCC(=O)N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,7-8-15)6-5-12(18)17-9-3-4-11(10-17)13(16)19/h11H,3-10,15H2,1-2H3,(H2,16,19) |
| InChIKey | PBYYMSSTEVVUBD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |